About N-ethyl-3-phenylpentan-3-amine;octadecanamide;hydrochloride
N-ethyl-3-phenylpentan-3-amine;octadecanamide;hydrochloride (PubChem CID 174665046) has the molecular formula C31H59ClN2O
and a molecular weight of 511.28 g/mol. Its IUPAC name is N-ethyl-3-phenylpentan-3-amine;octadecanamide;hydrochloride.
Molecular Properties
| Compound Name | N-ethyl-3-phenylpentan-3-amine;octadecanamide;hydrochloride |
| PubChem CID | 174665046 |
| Molecular Formula | C31H59ClN2O |
| Molecular Weight | 511.28 g/mol |
| Exact Mass | 510.43 |
| IUPAC Name | N-ethyl-3-phenylpentan-3-amine;octadecanamide;hydrochloride |
| SMILES | CCCCCCCCCCCCCCCCCC(N)=O.CCNC(CC)(CC)c1ccccc1.Cl |
| InChI | InChI=1S/C18H37NO.C13H21N.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4-13(5-2,14-6-3)12-10-8-7-9-11-12;/h2-17H2,1H3,(H2,19,20);7-11,14H,4-6H2,1-3H3;1H |
| InChIKey | FQSOVUKTVFWDJU-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 511.28 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-3-phenylpentan-3-amine;octadecanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3-phenylpentan-3-amine;octadecanamide;hydrochloride?
The IUPAC name of N-ethyl-3-phenylpentan-3-amine;octadecanamide;hydrochloride (CID 174665046) is N-ethyl-3-phenylpentan-3-amine;octadecanamide;hydrochloride.
What is the SMILES notation for N-ethyl-3-phenylpentan-3-amine;octadecanamide;hydrochloride?
The canonical SMILES for N-ethyl-3-phenylpentan-3-amine;octadecanamide;hydrochloride is CCCCCCCCCCCCCCCCCC(N)=O.CCNC(CC)(CC)c1ccccc1.Cl.
What is the InChIKey of N-ethyl-3-phenylpentan-3-amine;octadecanamide;hydrochloride?
The InChIKey is FQSOVUKTVFWDJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO.C13H21N.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4-13(5-2,14-6-3)12-10-8-7-9-11-12;/h2-17H2,1H3,(H2,19,20);7-11,14H,4-6H2,1-3H3;1H.
What are the key properties of N-ethyl-3-phenylpentan-3-amine;octadecanamide;hydrochloride?
N-ethyl-3-phenylpentan-3-amine;octadecanamide;hydrochloride has a molecular weight of 511.28 g/mol, XLogP of 9.47, 21 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3-phenylpentan-3-amine;octadecanamide;hydrochloride is sourced from PubChem (CID 174665046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).