C21H31N2NaO4 — CID 175435679
sodium;2-amino-3-(1H-indol-3-yl)propanoic acid;decanoate (PubChem CID 175435679) has the molecular formula C21H31N2NaO4 and a molecular weight of 398.48 g/mol. Its IUPAC name is sodium;2-amino-3-(1H-indol-3-yl)propanoic acid;decanoate.
| Compound Name | sodium;2-amino-3-(1H-indol-3-yl)propanoic acid;decanoate |
|---|---|
| PubChem CID | 175435679 |
| Molecular Formula | C21H31N2NaO4 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | sodium;2-amino-3-(1H-indol-3-yl)propanoic acid;decanoate |
| SMILES | CCCCCCCCCC(=O)[O-].NC(Cc1c[nH]c2ccccc12)C(=O)O.[Na+] |
| InChI | InChI=1S/C11H12N2O2.C10H20O2.Na/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10;1-2-3-4-5-6-7-8-9-10(11)12;/h1-4,6,9,13H,5,12H2,(H,14,15);2-9H2,1H3,(H,11,12);/q;;+1/p-1 |
| InChIKey | IKTMPZGEIIVQRA-UHFFFAOYSA-M |
| XLogP | 0.00 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|