C27H48N2O2P+ — CID 174977427
2-amino-3-(1H-indol-3-yl)propanoic acid;tetrabutylphosphanium (PubChem CID 174977427) has the molecular formula C27H48N2O2P+ and a molecular weight of 463.67 g/mol. Its IUPAC name is 2-amino-3-(1H-indol-3-yl)propanoic acid;tetrabutylphosphanium.
| Compound Name | 2-amino-3-(1H-indol-3-yl)propanoic acid;tetrabutylphosphanium |
|---|---|
| PubChem CID | 174977427 |
| Molecular Formula | C27H48N2O2P+ |
| Molecular Weight | 463.67 g/mol |
| Exact Mass | 463.34 |
| IUPAC Name | 2-amino-3-(1H-indol-3-yl)propanoic acid;tetrabutylphosphanium |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCC.NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H36P.C11H12N2O2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h5-16H2,1-4H3;1-4,6,9,13H,5,12H2,(H,14,15)/q+1; |
| InChIKey | HKPSRIIXZRYYRO-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.67 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|