C21H28BNO4 — CID 175436340
N-[2-[7-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]ethyl]acetamide (PubChem CID 175436340) has the molecular formula C21H28BNO4 and a molecular weight of 369.27 g/mol. Its IUPAC name is N-[2-[7-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]ethyl]acetamide.
| Compound Name | N-[2-[7-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 175436340 |
| Molecular Formula | C21H28BNO4 |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | N-[2-[7-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]ethyl]acetamide |
| SMILES | COc1ccc2cc(B3OC(C)(C)C(C)(C)O3)cc(CCNC(C)=O)c2c1 |
| InChI | InChI=1S/C21H28BNO4/c1-14(24)23-10-9-16-12-17(22-26-20(2,3)21(4,5)27-22)11-15-7-8-18(25-6)13-19(15)16/h7-8,11-13H,9-10H2,1-6H3,(H,23,24) |
| InChIKey | YJXBLZFLFQBMDD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|