About N'-tert-butyl-N-ethylmethanediimine;2-methylprop-2-enoic acid
N'-tert-butyl-N-ethylmethanediimine;2-methylprop-2-enoic acid (PubChem CID 175438196) has the molecular formula C11H20N2O2
and a molecular weight of 212.29 g/mol. Its IUPAC name is N'-tert-butyl-N-ethylmethanediimine;2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | N'-tert-butyl-N-ethylmethanediimine;2-methylprop-2-enoic acid |
| PubChem CID | 175438196 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | N'-tert-butyl-N-ethylmethanediimine;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CCN=C=NC(C)(C)C |
| InChI | InChI=1S/C7H14N2.C4H6O2/c1-5-8-6-9-7(2,3)4;1-3(2)4(5)6/h5H2,1-4H3;1H2,2H3,(H,5,6) |
| InChIKey | VFCHTIOOKFEFRX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N'-tert-butyl-N-ethylmethanediimine;2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-tert-butyl-N-ethylmethanediimine;2-methylprop-2-enoic acid?
The IUPAC name of N'-tert-butyl-N-ethylmethanediimine;2-methylprop-2-enoic acid (CID 175438196) is N'-tert-butyl-N-ethylmethanediimine;2-methylprop-2-enoic acid.
What is the SMILES notation for N'-tert-butyl-N-ethylmethanediimine;2-methylprop-2-enoic acid?
The canonical SMILES for N'-tert-butyl-N-ethylmethanediimine;2-methylprop-2-enoic acid is C=C(C)C(=O)O.CCN=C=NC(C)(C)C.
What is the InChIKey of N'-tert-butyl-N-ethylmethanediimine;2-methylprop-2-enoic acid?
The InChIKey is VFCHTIOOKFEFRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2.C4H6O2/c1-5-8-6-9-7(2,3)4;1-3(2)4(5)6/h5H2,1-4H3;1H2,2H3,(H,5,6).
What are the key properties of N'-tert-butyl-N-ethylmethanediimine;2-methylprop-2-enoic acid?
N'-tert-butyl-N-ethylmethanediimine;2-methylprop-2-enoic acid has a molecular weight of 212.29 g/mol, XLogP of 2.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-tert-butyl-N-ethylmethanediimine;2-methylprop-2-enoic acid is sourced from PubChem (CID 175438196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).