C17H14F3N3OS — CID 175441034
N-ethyl-2-phenyl-3-[3-(trifluoromethoxy)phenyl]-1,2,4-thiadiazol-5-imine (PubChem CID 175441034) has the molecular formula C17H14F3N3OS and a molecular weight of 365.38 g/mol. Its IUPAC name is N-ethyl-2-phenyl-3-[3-(trifluoromethoxy)phenyl]-1,2,4-thiadiazol-5-imine.
| Compound Name | N-ethyl-2-phenyl-3-[3-(trifluoromethoxy)phenyl]-1,2,4-thiadiazol-5-imine |
|---|---|
| PubChem CID | 175441034 |
| Molecular Formula | C17H14F3N3OS |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | N-ethyl-2-phenyl-3-[3-(trifluoromethoxy)phenyl]-1,2,4-thiadiazol-5-imine |
| SMILES | CC/N=c1/nc(-c2cccc(OC(F)(F)F)c2)n(-c2ccccc2)s1 |
| InChI | InChI=1S/C17H14F3N3OS/c1-2-21-16-22-15(23(25-16)13-8-4-3-5-9-13)12-7-6-10-14(11-12)24-17(18,19)20/h3-11H,2H2,1H3/b21-16- |
| InChIKey | CHLXIZKKYAADPV-PGMHBOJBSA-N |
| XLogP | 4.42 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'} |
|---|