C17H18BrN3O2S — CID 56964905
2-[[2-(4-methoxyphenyl)-3-phenyl-1,2,4-thiadiazol-5-ylidene]amino]ethanol;hydrobromide (PubChem CID 56964905) has the molecular formula C17H18BrN3O2S and a molecular weight of 408.32 g/mol. Its IUPAC name is 2-[[2-(4-methoxyphenyl)-3-phenyl-1,2,4-thiadiazol-5-ylidene]amino]ethanol;hydrobromide.
| Compound Name | 2-[[2-(4-methoxyphenyl)-3-phenyl-1,2,4-thiadiazol-5-ylidene]amino]ethanol;hydrobromide |
|---|---|
| PubChem CID | 56964905 |
| Molecular Formula | C17H18BrN3O2S |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | 2-[[2-(4-methoxyphenyl)-3-phenyl-1,2,4-thiadiazol-5-ylidene]amino]ethanol;hydrobromide |
| SMILES | Br.COc1ccc(-n2s/c(=N/CCO)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H17N3O2S.BrH/c1-22-15-9-7-14(8-10-15)20-16(13-5-3-2-4-6-13)19-17(23-20)18-11-12-21;/h2-10,21H,11-12H2,1H3;1H/b18-17+; |
| InChIKey | XZEZGDVMKUWWEA-ZAGWXBKKSA-N |
| XLogP | 3.08 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'} |
|---|