C21H16N4S2 — CID 27162453
1-(2,3-diphenyl-1,2,4-thiadiazol-5-ylidene)-3-phenylthiourea (PubChem CID 27162453) has the molecular formula C21H16N4S2 and a molecular weight of 388.52 g/mol. Its IUPAC name is 1-(2,3-diphenyl-1,2,4-thiadiazol-5-ylidene)-3-phenylthiourea.
| Compound Name | 1-(2,3-diphenyl-1,2,4-thiadiazol-5-ylidene)-3-phenylthiourea |
|---|---|
| PubChem CID | 27162453 |
| Molecular Formula | C21H16N4S2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 1-(2,3-diphenyl-1,2,4-thiadiazol-5-ylidene)-3-phenylthiourea |
| SMILES | S=C(N=c1nc(-c2ccccc2)n(-c2ccccc2)s1)Nc1ccccc1 |
| InChI | InChI=1S/C21H16N4S2/c26-20(22-17-12-6-2-7-13-17)24-21-23-19(16-10-4-1-5-11-16)25(27-21)18-14-8-3-9-15-18/h1-15H,(H,22,26) |
| InChIKey | HFZBTCXFGRBKCG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|