About (1E)-1-(3,4-dimethyl-1,3-thiazol-2-ylidene)-3-phenylthiourea
(1E)-1-(3,4-dimethyl-1,3-thiazol-2-ylidene)-3-phenylthiourea (PubChem CID 5400558) has the molecular formula C12H13N3S2
and a molecular weight of 263.39 g/mol. Its IUPAC name is (1E)-1-(3,4-dimethyl-1,3-thiazol-2-ylidene)-3-phenylthiourea.
Molecular Properties
| Compound Name | (1E)-1-(3,4-dimethyl-1,3-thiazol-2-ylidene)-3-phenylthiourea |
| PubChem CID | 5400558 |
| Molecular Formula | C12H13N3S2 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | (1E)-1-(3,4-dimethyl-1,3-thiazol-2-ylidene)-3-phenylthiourea |
| SMILES | Cc1cs/c(=N/C(=S)Nc2ccccc2)n1C |
| InChI | InChI=1S/C12H13N3S2/c1-9-8-17-12(15(9)2)14-11(16)13-10-6-4-3-5-7-10/h3-8H,1-2H3,(H,13,16)/b14-12+ |
| InChIKey | KOKFXPFIJLSBNY-WYMLVPIESA-N |
| XLogP | 2.69 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-(3,4-dimethyl-1,3-thiazol-2-ylidene)-3-phenylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-(3,4-dimethyl-1,3-thiazol-2-ylidene)-3-phenylthiourea?
The IUPAC name of (1E)-1-(3,4-dimethyl-1,3-thiazol-2-ylidene)-3-phenylthiourea (CID 5400558) is (1E)-1-(3,4-dimethyl-1,3-thiazol-2-ylidene)-3-phenylthiourea.
What is the SMILES notation for (1E)-1-(3,4-dimethyl-1,3-thiazol-2-ylidene)-3-phenylthiourea?
The canonical SMILES for (1E)-1-(3,4-dimethyl-1,3-thiazol-2-ylidene)-3-phenylthiourea is Cc1cs/c(=N/C(=S)Nc2ccccc2)n1C.
What is the InChIKey of (1E)-1-(3,4-dimethyl-1,3-thiazol-2-ylidene)-3-phenylthiourea?
The InChIKey is KOKFXPFIJLSBNY-WYMLVPIESA-N. The full InChI is InChI=1S/C12H13N3S2/c1-9-8-17-12(15(9)2)14-11(16)13-10-6-4-3-5-7-10/h3-8H,1-2H3,(H,13,16)/b14-12+.
What are the key properties of (1E)-1-(3,4-dimethyl-1,3-thiazol-2-ylidene)-3-phenylthiourea?
(1E)-1-(3,4-dimethyl-1,3-thiazol-2-ylidene)-3-phenylthiourea has a molecular weight of 263.39 g/mol, XLogP of 2.69, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-(3,4-dimethyl-1,3-thiazol-2-ylidene)-3-phenylthiourea is sourced from PubChem (CID 5400558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).