C12H13N3S2 — CID 5400558
(1E)-1-(3,4-dimethyl-1,3-thiazol-2-ylidene)-3-phenylthiourea (PubChem CID 5400558) has the molecular formula C12H13N3S2 and a molecular weight of 263.39 g/mol. Its IUPAC name is (1E)-1-(3,4-dimethyl-1,3-thiazol-2-ylidene)-3-phenylthiourea.
| Compound Name | (1E)-1-(3,4-dimethyl-1,3-thiazol-2-ylidene)-3-phenylthiourea |
|---|---|
| PubChem CID | 5400558 |
| Molecular Formula | C12H13N3S2 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | (1E)-1-(3,4-dimethyl-1,3-thiazol-2-ylidene)-3-phenylthiourea |
| SMILES | Cc1cs/c(=N/C(=S)Nc2ccccc2)n1C |
| InChI | InChI=1S/C12H13N3S2/c1-9-8-17-12(15(9)2)14-11(16)13-10-6-4-3-5-7-10/h3-8H,1-2H3,(H,13,16)/b14-12+ |
| InChIKey | KOKFXPFIJLSBNY-WYMLVPIESA-N |
| XLogP | 2.69 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|