C18H19N3S — CID 11246275
2-(3-methylphenyl)-3-phenyl-N-propan-2-yl-1,2,4-thiadiazol-5-imine (PubChem CID 11246275) has the molecular formula C18H19N3S and a molecular weight of 309.44 g/mol. Its IUPAC name is 2-(3-methylphenyl)-3-phenyl-N-propan-2-yl-1,2,4-thiadiazol-5-imine.
| Compound Name | 2-(3-methylphenyl)-3-phenyl-N-propan-2-yl-1,2,4-thiadiazol-5-imine |
|---|---|
| PubChem CID | 11246275 |
| Molecular Formula | C18H19N3S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 2-(3-methylphenyl)-3-phenyl-N-propan-2-yl-1,2,4-thiadiazol-5-imine |
| SMILES | Cc1cccc(-n2s/c(=N/C(C)C)nc2-c2ccccc2)c1 |
| InChI | InChI=1S/C18H19N3S/c1-13(2)19-18-20-17(15-9-5-4-6-10-15)21(22-18)16-11-7-8-14(3)12-16/h4-13H,1-3H3/b19-18+ |
| InChIKey | UJARYCJUAIWCDI-VHEBQXMUSA-N |
| XLogP | 4.22 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'} |
|---|