C27H32O3 — CID 175442713
2-(hydroxymethyl)-2-[1,1,2-tris(4-methylphenyl)ethyl]propane-1,3-diol (PubChem CID 175442713) has the molecular formula C27H32O3 and a molecular weight of 404.55 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-[1,1,2-tris(4-methylphenyl)ethyl]propane-1,3-diol.
| Compound Name | 2-(hydroxymethyl)-2-[1,1,2-tris(4-methylphenyl)ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 175442713 |
| Molecular Formula | C27H32O3 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 2-(hydroxymethyl)-2-[1,1,2-tris(4-methylphenyl)ethyl]propane-1,3-diol |
| SMILES | Cc1ccc(CC(c2ccc(C)cc2)(c2ccc(C)cc2)C(CO)(CO)CO)cc1 |
| InChI | InChI=1S/C27H32O3/c1-20-4-10-23(11-5-20)16-27(26(17-28,18-29)19-30,24-12-6-21(2)7-13-24)25-14-8-22(3)9-15-25/h4-15,28-30H,16-19H2,1-3H3 |
| InChIKey | LJWMUUSMHKPGBA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |