About dithiirane-3-thione;1-methoxy-4-prop-1-enylbenzene
dithiirane-3-thione;1-methoxy-4-prop-1-enylbenzene (PubChem CID 175445582) has the molecular formula C11H12OS3
and a molecular weight of 256.42 g/mol. Its IUPAC name is dithiirane-3-thione;1-methoxy-4-prop-1-enylbenzene.
Molecular Properties
| Compound Name | dithiirane-3-thione;1-methoxy-4-prop-1-enylbenzene |
| PubChem CID | 175445582 |
| Molecular Formula | C11H12OS3 |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | dithiirane-3-thione;1-methoxy-4-prop-1-enylbenzene |
| SMILES | CC=Cc1ccc(OC)cc1.S=C1SS1 |
| InChI | InChI=1S/C10H12O.CS3/c1-3-4-9-5-7-10(11-2)8-6-9;2-1-3-4-1/h3-8H,1-2H3; |
| InChIKey | ZMSNEVCPNDEVIZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze dithiirane-3-thione;1-methoxy-4-prop-1-enylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dithiirane-3-thione;1-methoxy-4-prop-1-enylbenzene?
The IUPAC name of dithiirane-3-thione;1-methoxy-4-prop-1-enylbenzene (CID 175445582) is dithiirane-3-thione;1-methoxy-4-prop-1-enylbenzene.
What is the SMILES notation for dithiirane-3-thione;1-methoxy-4-prop-1-enylbenzene?
The canonical SMILES for dithiirane-3-thione;1-methoxy-4-prop-1-enylbenzene is CC=Cc1ccc(OC)cc1.S=C1SS1.
What is the InChIKey of dithiirane-3-thione;1-methoxy-4-prop-1-enylbenzene?
The InChIKey is ZMSNEVCPNDEVIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O.CS3/c1-3-4-9-5-7-10(11-2)8-6-9;2-1-3-4-1/h3-8H,1-2H3;.
What are the key properties of dithiirane-3-thione;1-methoxy-4-prop-1-enylbenzene?
dithiirane-3-thione;1-methoxy-4-prop-1-enylbenzene has a molecular weight of 256.42 g/mol, XLogP of 4.39, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dithiirane-3-thione;1-methoxy-4-prop-1-enylbenzene is sourced from PubChem (CID 175445582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).