About 1H-indole;1-methoxy-4-prop-1-enylbenzene
1H-indole;1-methoxy-4-prop-1-enylbenzene (PubChem CID 67195673) has the molecular formula C18H19NO
and a molecular weight of 265.36 g/mol. Its IUPAC name is 1H-indole;1-methoxy-4-prop-1-enylbenzene.
Molecular Properties
| Compound Name | 1H-indole;1-methoxy-4-prop-1-enylbenzene |
| PubChem CID | 67195673 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 1H-indole;1-methoxy-4-prop-1-enylbenzene |
| SMILES | CC=Cc1ccc(OC)cc1.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C10H12O.C8H7N/c1-3-4-9-5-7-10(11-2)8-6-9;1-2-4-8-7(3-1)5-6-9-8/h3-8H,1-2H3;1-6,9H |
| InChIKey | CJOBXRICJQEFRI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-indole;1-methoxy-4-prop-1-enylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole;1-methoxy-4-prop-1-enylbenzene?
The IUPAC name of 1H-indole;1-methoxy-4-prop-1-enylbenzene (CID 67195673) is 1H-indole;1-methoxy-4-prop-1-enylbenzene.
What is the SMILES notation for 1H-indole;1-methoxy-4-prop-1-enylbenzene?
The canonical SMILES for 1H-indole;1-methoxy-4-prop-1-enylbenzene is CC=Cc1ccc(OC)cc1.c1ccc2[nH]ccc2c1.
What is the InChIKey of 1H-indole;1-methoxy-4-prop-1-enylbenzene?
The InChIKey is CJOBXRICJQEFRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O.C8H7N/c1-3-4-9-5-7-10(11-2)8-6-9;1-2-4-8-7(3-1)5-6-9-8/h3-8H,1-2H3;1-6,9H.
What are the key properties of 1H-indole;1-methoxy-4-prop-1-enylbenzene?
1H-indole;1-methoxy-4-prop-1-enylbenzene has a molecular weight of 265.36 g/mol, XLogP of 4.90, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole;1-methoxy-4-prop-1-enylbenzene is sourced from PubChem (CID 67195673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).