C10H24O3SSi — CID 175446121
3-(1,3-diethoxypropoxysilyl)propane-1-thiol (PubChem CID 175446121) has the molecular formula C10H24O3SSi and a molecular weight of 252.45 g/mol. Its IUPAC name is 3-(1,3-diethoxypropoxysilyl)propane-1-thiol.
| Compound Name | 3-(1,3-diethoxypropoxysilyl)propane-1-thiol |
|---|---|
| PubChem CID | 175446121 |
| Molecular Formula | C10H24O3SSi |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 3-(1,3-diethoxypropoxysilyl)propane-1-thiol |
| SMILES | CCOCCC(OCC)O[SiH2]CCCS |
| InChI | InChI=1S/C10H24O3SSi/c1-3-11-7-6-10(12-4-2)13-15-9-5-8-14/h10,14H,3-9,15H2,1-2H3 |
| InChIKey | AMUWCAUTDPUVFQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|