About azane;fluoro 2-(2-methoxypropoxy)propanoate
azane;fluoro 2-(2-methoxypropoxy)propanoate (PubChem CID 175447358) has the molecular formula C7H16FNO4
and a molecular weight of 197.21 g/mol. Its IUPAC name is azane;fluoro 2-(2-methoxypropoxy)propanoate.
Molecular Properties
| Compound Name | azane;fluoro 2-(2-methoxypropoxy)propanoate |
| PubChem CID | 175447358 |
| Molecular Formula | C7H16FNO4 |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | azane;fluoro 2-(2-methoxypropoxy)propanoate |
| SMILES | COC(C)COC(C)C(=O)OF.N |
| InChI | InChI=1S/C7H13FO4.H3N/c1-5(10-3)4-11-6(2)7(9)12-8;/h5-6H,4H2,1-3H3;1H3 |
| InChIKey | VTWHGQKKYPNKFO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 79.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze azane;fluoro 2-(2-methoxypropoxy)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;fluoro 2-(2-methoxypropoxy)propanoate?
The IUPAC name of azane;fluoro 2-(2-methoxypropoxy)propanoate (CID 175447358) is azane;fluoro 2-(2-methoxypropoxy)propanoate.
What is the SMILES notation for azane;fluoro 2-(2-methoxypropoxy)propanoate?
The canonical SMILES for azane;fluoro 2-(2-methoxypropoxy)propanoate is COC(C)COC(C)C(=O)OF.N.
What is the InChIKey of azane;fluoro 2-(2-methoxypropoxy)propanoate?
The InChIKey is VTWHGQKKYPNKFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13FO4.H3N/c1-5(10-3)4-11-6(2)7(9)12-8;/h5-6H,4H2,1-3H3;1H3.
What are the key properties of azane;fluoro 2-(2-methoxypropoxy)propanoate?
azane;fluoro 2-(2-methoxypropoxy)propanoate has a molecular weight of 197.21 g/mol, XLogP of 1.02, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;fluoro 2-(2-methoxypropoxy)propanoate is sourced from PubChem (CID 175447358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).