C8H12O7-2 — CID 18717532
2-hydroxy-3-(2-methoxypropoxy)butanedioate (PubChem CID 18717532) has the molecular formula C8H12O7-2 and a molecular weight of 220.18 g/mol. Its IUPAC name is 2-hydroxy-3-(2-methoxypropoxy)butanedioate.
| Compound Name | 2-hydroxy-3-(2-methoxypropoxy)butanedioate |
|---|---|
| PubChem CID | 18717532 |
| Molecular Formula | C8H12O7-2 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 2-hydroxy-3-(2-methoxypropoxy)butanedioate |
| SMILES | COC(C)COC(C(=O)[O-])C(O)C(=O)[O-] |
| InChI | InChI=1S/C8H14O7/c1-4(14-2)3-15-6(8(12)13)5(9)7(10)11/h4-6,9H,3H2,1-2H3,(H,10,11)(H,12,13)/p-2 |
| InChIKey | VFTNFQGPHXGWMW-UHFFFAOYSA-L |
| XLogP | -3.73 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | -3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |