C16H15F3N4O3 — CID 175454941
3-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)methyl]phenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole;formamide (PubChem CID 175454941) has the molecular formula C16H15F3N4O3 and a molecular weight of 368.32 g/mol. Its IUPAC name is 3-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)methyl]phenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole;formamide.
| Compound Name | 3-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)methyl]phenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole;formamide |
|---|---|
| PubChem CID | 175454941 |
| Molecular Formula | C16H15F3N4O3 |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 3-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)methyl]phenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole;formamide |
| SMILES | Cc1noc(Cc2ccc(-c3noc(C(F)(F)F)n3)cc2)c1C.NC=O |
| InChI | InChI=1S/C15H12F3N3O2.CH3NO/c1-8-9(2)20-22-12(8)7-10-3-5-11(6-4-10)13-19-14(23-21-13)15(16,17)18;2-1-3/h3-6H,7H2,1-2H3;1H,(H2,2,3) |
| InChIKey | GWROAPNFGPTBSE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|