C21H23N3O3S — CID 175459247
4-[2-(3,5-dimethoxyphenyl)ethynyl]-2-(1-prop-1-enylpyrrolidin-3-yl)-1,3-thiazole-5-carboxamide (PubChem CID 175459247) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is 4-[2-(3,5-dimethoxyphenyl)ethynyl]-2-(1-prop-1-enylpyrrolidin-3-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-[2-(3,5-dimethoxyphenyl)ethynyl]-2-(1-prop-1-enylpyrrolidin-3-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 175459247 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 4-[2-(3,5-dimethoxyphenyl)ethynyl]-2-(1-prop-1-enylpyrrolidin-3-yl)-1,3-thiazole-5-carboxamide |
| SMILES | CC=CN1CCC(c2nc(C#Cc3cc(OC)cc(OC)c3)c(C(N)=O)s2)C1 |
| InChI | InChI=1S/C21H23N3O3S/c1-4-8-24-9-7-15(13-24)21-23-18(19(28-21)20(22)25)6-5-14-10-16(26-2)12-17(11-14)27-3/h4,8,10-12,15H,7,9,13H2,1-3H3,(H2,22,25) |
| InChIKey | OFJPGBYSRXWZIY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|