About 1-morpholin-4-ylethanone;1-morpholin-2-ylprop-2-en-1-one
1-morpholin-4-ylethanone;1-morpholin-2-ylprop-2-en-1-one (PubChem CID 175463061) has the molecular formula C13H22N2O4
and a molecular weight of 270.33 g/mol. Its IUPAC name is 1-morpholin-4-ylethanone;1-morpholin-2-ylprop-2-en-1-one.
Molecular Properties
| Compound Name | 1-morpholin-4-ylethanone;1-morpholin-2-ylprop-2-en-1-one |
| PubChem CID | 175463061 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 1-morpholin-4-ylethanone;1-morpholin-2-ylprop-2-en-1-one |
| SMILES | C=CC(=O)C1CNCCO1.CC(=O)N1CCOCC1 |
| InChI | InChI=1S/C7H11NO2.C6H11NO2/c1-2-6(9)7-5-8-3-4-10-7;1-6(8)7-2-4-9-5-3-7/h2,7-8H,1,3-5H2;2-5H2,1H3 |
| InChIKey | ZODVCGRIJVSZDZ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-morpholin-4-ylethanone;1-morpholin-2-ylprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-4-ylethanone;1-morpholin-2-ylprop-2-en-1-one?
The IUPAC name of 1-morpholin-4-ylethanone;1-morpholin-2-ylprop-2-en-1-one (CID 175463061) is 1-morpholin-4-ylethanone;1-morpholin-2-ylprop-2-en-1-one.
What is the SMILES notation for 1-morpholin-4-ylethanone;1-morpholin-2-ylprop-2-en-1-one?
The canonical SMILES for 1-morpholin-4-ylethanone;1-morpholin-2-ylprop-2-en-1-one is C=CC(=O)C1CNCCO1.CC(=O)N1CCOCC1.
What is the InChIKey of 1-morpholin-4-ylethanone;1-morpholin-2-ylprop-2-en-1-one?
The InChIKey is ZODVCGRIJVSZDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2.C6H11NO2/c1-2-6(9)7-5-8-3-4-10-7;1-6(8)7-2-4-9-5-3-7/h2,7-8H,1,3-5H2;2-5H2,1H3.
What are the key properties of 1-morpholin-4-ylethanone;1-morpholin-2-ylprop-2-en-1-one?
1-morpholin-4-ylethanone;1-morpholin-2-ylprop-2-en-1-one has a molecular weight of 270.33 g/mol, XLogP of -0.41, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-4-ylethanone;1-morpholin-2-ylprop-2-en-1-one is sourced from PubChem (CID 175463061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).