C26H26O — CID 175463803
2-[3-tert-butyl-2-(1H-inden-1-yl)phenyl]-4-methylphenol (PubChem CID 175463803) has the molecular formula C26H26O and a molecular weight of 354.49 g/mol. Its IUPAC name is 2-[3-tert-butyl-2-(1H-inden-1-yl)phenyl]-4-methylphenol.
| Compound Name | 2-[3-tert-butyl-2-(1H-inden-1-yl)phenyl]-4-methylphenol |
|---|---|
| PubChem CID | 175463803 |
| Molecular Formula | C26H26O |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 2-[3-tert-butyl-2-(1H-inden-1-yl)phenyl]-4-methylphenol |
| SMILES | Cc1ccc(O)c(-c2cccc(C(C)(C)C)c2C2C=Cc3ccccc32)c1 |
| InChI | InChI=1S/C26H26O/c1-17-12-15-24(27)22(16-17)20-10-7-11-23(26(2,3)4)25(20)21-14-13-18-8-5-6-9-19(18)21/h5-16,21,27H,1-4H3 |
| InChIKey | IZLAAFIGWYZRBP-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |