C12H17N5O2 — CID 175465593
1-(diaminomethylidene)-2-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]guanidine (PubChem CID 175465593) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 175465593 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 1-(diaminomethylidene)-2-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]guanidine |
| SMILES | CC(/N=C(\N)N=C(N)N)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C12H17N5O2/c1-7(16-12(15)17-11(13)14)8-2-3-9-10(6-8)19-5-4-18-9/h2-3,6-7H,4-5H2,1H3,(H6,13,14,15,16,17) |
| InChIKey | VVLFVUHPIYBJOU-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|