C11H26O5Si — CID 175468457
diethoxy-(3-ethoxy-3,3-dimethoxypropyl)silane (PubChem CID 175468457) has the molecular formula C11H26O5Si and a molecular weight of 266.41 g/mol. Its IUPAC name is diethoxy-(3-ethoxy-3,3-dimethoxypropyl)silane.
| Compound Name | diethoxy-(3-ethoxy-3,3-dimethoxypropyl)silane |
|---|---|
| PubChem CID | 175468457 |
| Molecular Formula | C11H26O5Si |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | diethoxy-(3-ethoxy-3,3-dimethoxypropyl)silane |
| SMILES | CCO[SiH](CCC(OC)(OC)OCC)OCC |
| InChI | InChI=1S/C11H26O5Si/c1-6-14-11(12-4,13-5)9-10-17(15-7-2)16-8-3/h17H,6-10H2,1-5H3 |
| InChIKey | MRXPWMZIDFZDHM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|