C25H23N3O3 — CID 175469021
2-methoxyethyl 2-(9-ethylcarbazol-3-yl)-3H-benzimidazole-5-carboxylate (PubChem CID 175469021) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is 2-methoxyethyl 2-(9-ethylcarbazol-3-yl)-3H-benzimidazole-5-carboxylate.
| Compound Name | 2-methoxyethyl 2-(9-ethylcarbazol-3-yl)-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 175469021 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 2-methoxyethyl 2-(9-ethylcarbazol-3-yl)-3H-benzimidazole-5-carboxylate |
| SMILES | CCn1c2ccccc2c2cc(-c3nc4ccc(C(=O)OCCOC)cc4[nH]3)ccc21 |
| InChI | InChI=1S/C25H23N3O3/c1-3-28-22-7-5-4-6-18(22)19-14-16(9-11-23(19)28)24-26-20-10-8-17(15-21(20)27-24)25(29)31-13-12-30-2/h4-11,14-15H,3,12-13H2,1-2H3,(H,26,27) |
| InChIKey | DDCVJXCIRIONTB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|