C23H25N3O3 — CID 175469156
3-(1'-methyl-2'-oxospiro[cyclohexene-4,3'-indole]-1-yl)-1-(oxan-2-yl)pyrazole-4-carbaldehyde (PubChem CID 175469156) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 3-(1'-methyl-2'-oxospiro[cyclohexene-4,3'-indole]-1-yl)-1-(oxan-2-yl)pyrazole-4-carbaldehyde.
| Compound Name | 3-(1'-methyl-2'-oxospiro[cyclohexene-4,3'-indole]-1-yl)-1-(oxan-2-yl)pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 175469156 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 3-(1'-methyl-2'-oxospiro[cyclohexene-4,3'-indole]-1-yl)-1-(oxan-2-yl)pyrazole-4-carbaldehyde |
| SMILES | CN1C(=O)C2(CC=C(c3nn(C4CCCCO4)cc3C=O)CC2)c2ccccc21 |
| InChI | InChI=1S/C23H25N3O3/c1-25-19-7-3-2-6-18(19)23(22(25)28)11-9-16(10-12-23)21-17(15-27)14-26(24-21)20-8-4-5-13-29-20/h2-3,6-7,9,14-15,20H,4-5,8,10-13H2,1H3 |
| InChIKey | HADLMUFDYPVLAY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|