About sodium;hydride;pyrimidin-4-yl acetate
sodium;hydride;pyrimidin-4-yl acetate (PubChem CID 175470054) has the molecular formula C6H7N2NaO2
and a molecular weight of 162.12 g/mol. Its IUPAC name is sodium;hydride;pyrimidin-4-yl acetate.
Molecular Properties
| Compound Name | sodium;hydride;pyrimidin-4-yl acetate |
| PubChem CID | 175470054 |
| Molecular Formula | C6H7N2NaO2 |
| Molecular Weight | 162.12 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | sodium;hydride;pyrimidin-4-yl acetate |
| SMILES | CC(=O)Oc1ccncn1.[H-].[Na+] |
| InChI | InChI=1S/C6H6N2O2.Na.H/c1-5(9)10-6-2-3-7-4-8-6;;/h2-4H,1H3;;/q;+1;-1 |
| InChIKey | NBTIBTRXRHFYKY-UHFFFAOYSA-N |
| XLogP | -2.48 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.12 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze sodium;hydride;pyrimidin-4-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;pyrimidin-4-yl acetate?
The IUPAC name of sodium;hydride;pyrimidin-4-yl acetate (CID 175470054) is sodium;hydride;pyrimidin-4-yl acetate.
What is the SMILES notation for sodium;hydride;pyrimidin-4-yl acetate?
The canonical SMILES for sodium;hydride;pyrimidin-4-yl acetate is CC(=O)Oc1ccncn1.[H-].[Na+].
What is the InChIKey of sodium;hydride;pyrimidin-4-yl acetate?
The InChIKey is NBTIBTRXRHFYKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2.Na.H/c1-5(9)10-6-2-3-7-4-8-6;;/h2-4H,1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;pyrimidin-4-yl acetate?
sodium;hydride;pyrimidin-4-yl acetate has a molecular weight of 162.12 g/mol, XLogP of -2.48, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;pyrimidin-4-yl acetate is sourced from PubChem (CID 175470054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).