About formic acid;pyridin-2-yl acetate
formic acid;pyridin-2-yl acetate (PubChem CID 174913305) has the molecular formula C8H9NO4
and a molecular weight of 183.16 g/mol. Its IUPAC name is formic acid;pyridin-2-yl acetate.
Molecular Properties
| Compound Name | formic acid;pyridin-2-yl acetate |
| PubChem CID | 174913305 |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | formic acid;pyridin-2-yl acetate |
| SMILES | CC(=O)Oc1ccccn1.O=CO |
| InChI | InChI=1S/C7H7NO2.CH2O2/c1-6(9)10-7-4-2-3-5-8-7;2-1-3/h2-5H,1H3;1H,(H,2,3) |
| InChIKey | SWFLMHOOEQBAFU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;pyridin-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;pyridin-2-yl acetate?
The IUPAC name of formic acid;pyridin-2-yl acetate (CID 174913305) is formic acid;pyridin-2-yl acetate.
What is the SMILES notation for formic acid;pyridin-2-yl acetate?
The canonical SMILES for formic acid;pyridin-2-yl acetate is CC(=O)Oc1ccccn1.O=CO.
What is the InChIKey of formic acid;pyridin-2-yl acetate?
The InChIKey is SWFLMHOOEQBAFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.CH2O2/c1-6(9)10-7-4-2-3-5-8-7;2-1-3/h2-5H,1H3;1H,(H,2,3).
What are the key properties of formic acid;pyridin-2-yl acetate?
formic acid;pyridin-2-yl acetate has a molecular weight of 183.16 g/mol, XLogP of 0.71, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;pyridin-2-yl acetate is sourced from PubChem (CID 174913305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).