C41H41Cl2N7O8 — CID 175470310
[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl] 3-[4-[3-[3-cyano-4-(2,4-dichloro-5-methoxyanilino)-6-methoxyquinolin-7-yl]oxypropyl]piperazin-1-yl]propanoate (PubChem CID 175470310) has the molecular formula C41H41Cl2N7O8 and a molecular weight of 830.73 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl] 3-[4-[3-[3-cyano-4-(2,4-dichloro-5-methoxyanilino)-6-methoxyquinolin-7-yl]oxypropyl]piperazin-1-yl]propanoate.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl] 3-[4-[3-[3-cyano-4-(2,4-dichloro-5-methoxyanilino)-6-methoxyquinolin-7-yl]oxypropyl]piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 175470310 |
| Molecular Formula | C41H41Cl2N7O8 |
| Molecular Weight | 830.73 g/mol |
| Exact Mass | 829.24 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl] 3-[4-[3-[3-cyano-4-(2,4-dichloro-5-methoxyanilino)-6-methoxyquinolin-7-yl]oxypropyl]piperazin-1-yl]propanoate |
| SMILES | COc1cc(Nc2c(C#N)cnc3cc(OCCCN4CCN(CCC(=O)Oc5cccc6c5CN(C5CCC(=O)NC5=O)C6=O)CC4)c(OC)cc23)c(Cl)cc1Cl |
| InChI | InChI=1S/C41H41Cl2N7O8/c1-55-34-20-31(28(42)18-29(34)43)46-39-24(21-44)22-45-30-19-36(35(56-2)17-26(30)39)57-16-4-10-48-12-14-49(15-13-48)11-9-38(52)58-33-6-3-5-25-27(33)23-50(41(25)54)32-7-8-37(51)47-40(32)53/h3,5-6,17-20,22,32H,4,7-16,23H2,1-2H3,(H,45,46)(H,47,51,53) |
| InChIKey | MBPNNVAEYXSACT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 175.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.73 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|