C18H19F4N3O3 — CID 175471915
(6R)-1-propan-2-yl-3-[5-(1,2,2,2-tetrafluoroethoxy)-3-pyridinyl]-4,5,6,7-tetrahydroindazole-6-carboxylic acid (PubChem CID 175471915) has the molecular formula C18H19F4N3O3 and a molecular weight of 401.36 g/mol. Its IUPAC name is (6R)-1-propan-2-yl-3-[5-(1,2,2,2-tetrafluoroethoxy)-3-pyridinyl]-4,5,6,7-tetrahydroindazole-6-carboxylic acid.
| Compound Name | (6R)-1-propan-2-yl-3-[5-(1,2,2,2-tetrafluoroethoxy)-3-pyridinyl]-4,5,6,7-tetrahydroindazole-6-carboxylic acid |
|---|---|
| PubChem CID | 175471915 |
| Molecular Formula | C18H19F4N3O3 |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | (6R)-1-propan-2-yl-3-[5-(1,2,2,2-tetrafluoroethoxy)-3-pyridinyl]-4,5,6,7-tetrahydroindazole-6-carboxylic acid |
| SMILES | CC(C)n1nc(-c2cncc(OC(F)C(F)(F)F)c2)c2c1C[C@H](C(=O)O)CC2 |
| InChI | InChI=1S/C18H19F4N3O3/c1-9(2)25-14-6-10(16(26)27)3-4-13(14)15(24-25)11-5-12(8-23-7-11)28-17(19)18(20,21)22/h5,7-10,17H,3-4,6H2,1-2H3,(H,26,27)/t10-,17?/m1/s1 |
| InChIKey | PFRZGHPOQRNEKP-YQDUUYOCSA-N |
| XLogP | 3.95 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |