C24H31F3N4O3S — CID 169222695
(6R)-3-[2-(1,1-difluoroethyl)-5-fluoro-4-pyridinyl]-N-(4-methyl-1,1-dioxothian-4-yl)-1-propan-2-yl-4,5,6,7-tetrahydroindazole-6-carboxamide (PubChem CID 169222695) has the molecular formula C24H31F3N4O3S and a molecular weight of 512.60 g/mol. Its IUPAC name is (6R)-3-[2-(1,1-difluoroethyl)-5-fluoro-4-pyridinyl]-N-(4-methyl-1,1-dioxothian-4-yl)-1-propan-2-yl-4,5,6,7-tetrahydroindazole-6-carboxamide.
| Compound Name | (6R)-3-[2-(1,1-difluoroethyl)-5-fluoro-4-pyridinyl]-N-(4-methyl-1,1-dioxothian-4-yl)-1-propan-2-yl-4,5,6,7-tetrahydroindazole-6-carboxamide |
|---|---|
| PubChem CID | 169222695 |
| Molecular Formula | C24H31F3N4O3S |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | (6R)-3-[2-(1,1-difluoroethyl)-5-fluoro-4-pyridinyl]-N-(4-methyl-1,1-dioxothian-4-yl)-1-propan-2-yl-4,5,6,7-tetrahydroindazole-6-carboxamide |
| SMILES | CC(C)n1nc(-c2cc(C(C)(F)F)ncc2F)c2c1C[C@H](C(=O)NC1(C)CCS(=O)(=O)CC1)CC2 |
| InChI | InChI=1S/C24H31F3N4O3S/c1-14(2)31-19-11-15(22(32)29-23(3)7-9-35(33,34)10-8-23)5-6-16(19)21(30-31)17-12-20(24(4,26)27)28-13-18(17)25/h12-15H,5-11H2,1-4H3,(H,29,32)/t15-/m1/s1 |
| InChIKey | RMXFYQFUJHNTIR-OAHLLOKOSA-N |
| XLogP | 3.97 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |