C24H32F4N4O4S — CID 174236499
N-(1,1-dihydroxy-4-methylthian-4-yl)-3-(2-ethoxy-5-fluoro-4-pyridinyl)-1-(1,1,1-trifluoropropan-2-yl)-4,5,6,7-tetrahydroindazole-6-carboxamide (PubChem CID 174236499) has the molecular formula C24H32F4N4O4S and a molecular weight of 548.60 g/mol. Its IUPAC name is N-(1,1-dihydroxy-4-methylthian-4-yl)-3-(2-ethoxy-5-fluoro-4-pyridinyl)-1-(1,1,1-trifluoropropan-2-yl)-4,5,6,7-tetrahydroindazole-6-carboxamide.
| Compound Name | N-(1,1-dihydroxy-4-methylthian-4-yl)-3-(2-ethoxy-5-fluoro-4-pyridinyl)-1-(1,1,1-trifluoropropan-2-yl)-4,5,6,7-tetrahydroindazole-6-carboxamide |
|---|---|
| PubChem CID | 174236499 |
| Molecular Formula | C24H32F4N4O4S |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | N-(1,1-dihydroxy-4-methylthian-4-yl)-3-(2-ethoxy-5-fluoro-4-pyridinyl)-1-(1,1,1-trifluoropropan-2-yl)-4,5,6,7-tetrahydroindazole-6-carboxamide |
| SMILES | CCOc1cc(-c2nn(C(C)C(F)(F)F)c3c2CCC(C(=O)NC2(C)CCS(O)(O)CC2)C3)c(F)cn1 |
| InChI | InChI=1S/C24H32F4N4O4S/c1-4-36-20-12-17(18(25)13-29-20)21-16-6-5-15(11-19(16)32(31-21)14(2)24(26,27)28)22(33)30-23(3)7-9-37(34,35)10-8-23/h12-15,34-35H,4-11H2,1-3H3,(H,30,33) |
| InChIKey | VZYXWTKMHOAYJM-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |