About dicarbamoyloxyborinic acid
dicarbamoyloxyborinic acid (PubChem CID 175471984) has the molecular formula C2H5BN2O5
and a molecular weight of 147.88 g/mol. Its IUPAC name is dicarbamoyloxyborinic acid.
Molecular Properties
| Compound Name | dicarbamoyloxyborinic acid |
| PubChem CID | 175471984 |
| Molecular Formula | C2H5BN2O5 |
| Molecular Weight | 147.88 g/mol |
| Exact Mass | 148.03 |
| IUPAC Name | dicarbamoyloxyborinic acid |
| SMILES | NC(=O)OB(O)OC(N)=O |
| InChI | InChI=1S/C2H5BN2O5/c4-1(6)9-3(8)10-2(5)7/h8H,(H2,4,6)(H2,5,7) |
| InChIKey | HGHUFMKRMGXZSW-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.88 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dicarbamoyloxyborinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicarbamoyloxyborinic acid?
The IUPAC name of dicarbamoyloxyborinic acid (CID 175471984) is dicarbamoyloxyborinic acid.
What is the SMILES notation for dicarbamoyloxyborinic acid?
The canonical SMILES for dicarbamoyloxyborinic acid is NC(=O)OB(O)OC(N)=O.
What is the InChIKey of dicarbamoyloxyborinic acid?
The InChIKey is HGHUFMKRMGXZSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5BN2O5/c4-1(6)9-3(8)10-2(5)7/h8H,(H2,4,6)(H2,5,7).
What are the key properties of dicarbamoyloxyborinic acid?
dicarbamoyloxyborinic acid has a molecular weight of 147.88 g/mol, XLogP of -1.85, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dicarbamoyloxyborinic acid is sourced from PubChem (CID 175471984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).