C14H17BrClFN2O3 — CID 175473692
2-[[[2-(2-bromo-3-chloro-6-fluorophenyl)acetyl]-ethylamino]-methylamino]propanoic acid (PubChem CID 175473692) has the molecular formula C14H17BrClFN2O3 and a molecular weight of 395.66 g/mol. Its IUPAC name is 2-[[[2-(2-bromo-3-chloro-6-fluorophenyl)acetyl]-ethylamino]-methylamino]propanoic acid.
| Compound Name | 2-[[[2-(2-bromo-3-chloro-6-fluorophenyl)acetyl]-ethylamino]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 175473692 |
| Molecular Formula | C14H17BrClFN2O3 |
| Molecular Weight | 395.66 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 2-[[[2-(2-bromo-3-chloro-6-fluorophenyl)acetyl]-ethylamino]-methylamino]propanoic acid |
| SMILES | CCN(C(=O)Cc1c(F)ccc(Cl)c1Br)N(C)C(C)C(=O)O |
| InChI | InChI=1S/C14H17BrClFN2O3/c1-4-19(18(3)8(2)14(21)22)12(20)7-9-11(17)6-5-10(16)13(9)15/h5-6,8H,4,7H2,1-3H3,(H,21,22) |
| InChIKey | RYFKRCGLFPQSAD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.66 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|