C26H34O2 — CID 175474720
6-(4-tert-butyl-3-propylphenyl)hex-5-en-2-yl benzoate (PubChem CID 175474720) has the molecular formula C26H34O2 and a molecular weight of 378.56 g/mol. Its IUPAC name is 6-(4-tert-butyl-3-propylphenyl)hex-5-en-2-yl benzoate.
| Compound Name | 6-(4-tert-butyl-3-propylphenyl)hex-5-en-2-yl benzoate |
|---|---|
| PubChem CID | 175474720 |
| Molecular Formula | C26H34O2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 6-(4-tert-butyl-3-propylphenyl)hex-5-en-2-yl benzoate |
| SMILES | CCCc1cc(C=CCCC(C)OC(=O)c2ccccc2)ccc1C(C)(C)C |
| InChI | InChI=1S/C26H34O2/c1-6-12-23-19-21(17-18-24(23)26(3,4)5)14-11-10-13-20(2)28-25(27)22-15-8-7-9-16-22/h7-9,11,14-20H,6,10,12-13H2,1-5H3 |
| InChIKey | GUKMIYYAHXCMLG-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |