C17H19NO6S — CID 175476090
[4-(1-amino-1-oxopropan-2-yl)phenyl] methanesulfonate;benzoic acid (PubChem CID 175476090) has the molecular formula C17H19NO6S and a molecular weight of 365.41 g/mol. Its IUPAC name is [4-(1-amino-1-oxopropan-2-yl)phenyl] methanesulfonate;benzoic acid.
| Compound Name | [4-(1-amino-1-oxopropan-2-yl)phenyl] methanesulfonate;benzoic acid |
|---|---|
| PubChem CID | 175476090 |
| Molecular Formula | C17H19NO6S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | [4-(1-amino-1-oxopropan-2-yl)phenyl] methanesulfonate;benzoic acid |
| SMILES | CC(C(N)=O)c1ccc(OS(C)(=O)=O)cc1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C10H13NO4S.C7H6O2/c1-7(10(11)12)8-3-5-9(6-4-8)15-16(2,13)14;8-7(9)6-4-2-1-3-5-6/h3-7H,1-2H3,(H2,11,12);1-5H,(H,8,9) |
| InChIKey | AFOSZTAYIBRCHD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|