About oxetan-2-ol;trimethoxy(propyl)silane
oxetan-2-ol;trimethoxy(propyl)silane (PubChem CID 175477148) has the molecular formula C9H22O5Si
and a molecular weight of 238.36 g/mol. Its IUPAC name is oxetan-2-ol;trimethoxy(propyl)silane.
Molecular Properties
| Compound Name | oxetan-2-ol;trimethoxy(propyl)silane |
| PubChem CID | 175477148 |
| Molecular Formula | C9H22O5Si |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | oxetan-2-ol;trimethoxy(propyl)silane |
| SMILES | CCC[Si](OC)(OC)OC.OC1CCO1 |
| InChI | InChI=1S/C6H16O3Si.C3H6O2/c1-5-6-10(7-2,8-3)9-4;4-3-1-2-5-3/h5-6H2,1-4H3;3-4H,1-2H2 |
| InChIKey | QQZNZMTWCHXAST-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze oxetan-2-ol;trimethoxy(propyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxetan-2-ol;trimethoxy(propyl)silane?
The IUPAC name of oxetan-2-ol;trimethoxy(propyl)silane (CID 175477148) is oxetan-2-ol;trimethoxy(propyl)silane.
What is the SMILES notation for oxetan-2-ol;trimethoxy(propyl)silane?
The canonical SMILES for oxetan-2-ol;trimethoxy(propyl)silane is CCC[Si](OC)(OC)OC.OC1CCO1.
What is the InChIKey of oxetan-2-ol;trimethoxy(propyl)silane?
The InChIKey is QQZNZMTWCHXAST-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O3Si.C3H6O2/c1-5-6-10(7-2,8-3)9-4;4-3-1-2-5-3/h5-6H2,1-4H3;3-4H,1-2H2.
What are the key properties of oxetan-2-ol;trimethoxy(propyl)silane?
oxetan-2-ol;trimethoxy(propyl)silane has a molecular weight of 238.36 g/mol, XLogP of 1.00, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxetan-2-ol;trimethoxy(propyl)silane is sourced from PubChem (CID 175477148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).