C14H20O6 — CID 175477698
2-(hydroxymethyl)-2-methylpropane-1,3-diol;3-methoxyphthalaldehyde (PubChem CID 175477698) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-methylpropane-1,3-diol;3-methoxyphthalaldehyde.
| Compound Name | 2-(hydroxymethyl)-2-methylpropane-1,3-diol;3-methoxyphthalaldehyde |
|---|---|
| PubChem CID | 175477698 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-(hydroxymethyl)-2-methylpropane-1,3-diol;3-methoxyphthalaldehyde |
| SMILES | CC(CO)(CO)CO.COc1cccc(C=O)c1C=O |
| InChI | InChI=1S/C9H8O3.C5H12O3/c1-12-9-4-2-3-7(5-10)8(9)6-11;1-5(2-6,3-7)4-8/h2-6H,1H3;6-8H,2-4H2,1H3 |
| InChIKey | NXZXKVNXYPWWIL-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|