C25H24O5S — CID 175478715
2-[3-[2-(2-methoxyethoxy)ethoxy]-5-methylthiophen-2-yl]-7-methylphenanthrene-9,10-dione (PubChem CID 175478715) has the molecular formula C25H24O5S and a molecular weight of 436.53 g/mol. Its IUPAC name is 2-[3-[2-(2-methoxyethoxy)ethoxy]-5-methylthiophen-2-yl]-7-methylphenanthrene-9,10-dione.
| Compound Name | 2-[3-[2-(2-methoxyethoxy)ethoxy]-5-methylthiophen-2-yl]-7-methylphenanthrene-9,10-dione |
|---|---|
| PubChem CID | 175478715 |
| Molecular Formula | C25H24O5S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-[3-[2-(2-methoxyethoxy)ethoxy]-5-methylthiophen-2-yl]-7-methylphenanthrene-9,10-dione |
| SMILES | COCCOCCOc1cc(C)sc1-c1ccc2c(c1)C(=O)C(=O)c1cc(C)ccc1-2 |
| InChI | InChI=1S/C25H24O5S/c1-15-4-6-18-19-7-5-17(14-21(19)24(27)23(26)20(18)12-15)25-22(13-16(2)31-25)30-11-10-29-9-8-28-3/h4-7,12-14H,8-11H2,1-3H3 |
| InChIKey | KDXNTXHTQOSKMO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|