C11H21F3O2Si — CID 175482937
1-[2-(2,3,3-trifluoropropyl)oxasilinan-2-yl]butan-1-ol (PubChem CID 175482937) has the molecular formula C11H21F3O2Si and a molecular weight of 270.37 g/mol. Its IUPAC name is 1-[2-(2,3,3-trifluoropropyl)oxasilinan-2-yl]butan-1-ol.
| Compound Name | 1-[2-(2,3,3-trifluoropropyl)oxasilinan-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 175482937 |
| Molecular Formula | C11H21F3O2Si |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 1-[2-(2,3,3-trifluoropropyl)oxasilinan-2-yl]butan-1-ol |
| SMILES | CCCC(O)[Si]1(CC(F)C(F)F)CCCCO1 |
| InChI | InChI=1S/C11H21F3O2Si/c1-2-5-10(15)17(7-4-3-6-16-17)8-9(12)11(13)14/h9-11,15H,2-8H2,1H3 |
| InChIKey | RSTXFVPNGFRGMT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|