C37H35N7O5 — CID 175493842
6,7-dimethoxy-2-[1-[1-[3-(2-nitro-5-pyridin-3-yloxyphenyl)phenyl]-2H-tetrazol-3-yl]-2-phenylethyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 175493842) has the molecular formula C37H35N7O5 and a molecular weight of 657.73 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[1-[1-[3-(2-nitro-5-pyridin-3-yloxyphenyl)phenyl]-2H-tetrazol-3-yl]-2-phenylethyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 6,7-dimethoxy-2-[1-[1-[3-(2-nitro-5-pyridin-3-yloxyphenyl)phenyl]-2H-tetrazol-3-yl]-2-phenylethyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 175493842 |
| Molecular Formula | C37H35N7O5 |
| Molecular Weight | 657.73 g/mol |
| Exact Mass | 657.27 |
| IUPAC Name | 6,7-dimethoxy-2-[1-[1-[3-(2-nitro-5-pyridin-3-yloxyphenyl)phenyl]-2H-tetrazol-3-yl]-2-phenylethyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1cc2c(cc1OC)CN(C(Cc1ccccc1)N1N=CN(c3cccc(-c4cc(Oc5cccnc5)ccc4[N+](=O)[O-])c3)N1)CC2 |
| InChI | InChI=1S/C37H35N7O5/c1-47-35-20-27-15-17-41(24-29(27)21-36(35)48-2)37(18-26-8-4-3-5-9-26)43-39-25-42(40-43)30-11-6-10-28(19-30)33-22-31(13-14-34(33)44(45)46)49-32-12-7-16-38-23-32/h3-14,16,19-23,25,37,40H,15,17-18,24H2,1-2H3 |
| InChIKey | UCIINHMEPBKNIF-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 117.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.73 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|