C9H9ClFNO — CID 175497049
5-chloro-4-fluoro-6-methoxy-2,3-dihydro-1H-isoindole (PubChem CID 175497049) has the molecular formula C9H9ClFNO and a molecular weight of 201.63 g/mol. Its IUPAC name is 5-chloro-4-fluoro-6-methoxy-2,3-dihydro-1H-isoindole.
| Compound Name | 5-chloro-4-fluoro-6-methoxy-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 175497049 |
| Molecular Formula | C9H9ClFNO |
| Molecular Weight | 201.63 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 5-chloro-4-fluoro-6-methoxy-2,3-dihydro-1H-isoindole |
| SMILES | COc1cc2c(c(F)c1Cl)CNC2 |
| InChI | InChI=1S/C9H9ClFNO/c1-13-7-2-5-3-12-4-6(5)9(11)8(7)10/h2,12H,3-4H2,1H3 |
| InChIKey | FSCQZGKFMVPFTK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.63 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |