C27H32N2O7S — CID 175497443
[2,3-bis(phenylmethoxycarbonylamino)-1-adamantyl] methanesulfonate (PubChem CID 175497443) has the molecular formula C27H32N2O7S and a molecular weight of 528.63 g/mol. Its IUPAC name is [2,3-bis(phenylmethoxycarbonylamino)-1-adamantyl] methanesulfonate.
| Compound Name | [2,3-bis(phenylmethoxycarbonylamino)-1-adamantyl] methanesulfonate |
|---|---|
| PubChem CID | 175497443 |
| Molecular Formula | C27H32N2O7S |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | [2,3-bis(phenylmethoxycarbonylamino)-1-adamantyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC12CC3CC(CC(NC(=O)OCc4ccccc4)(C3)C1NC(=O)OCc1ccccc1)C2 |
| InChI | InChI=1S/C27H32N2O7S/c1-37(32,33)36-27-15-21-12-22(16-27)14-26(13-21,29-25(31)35-18-20-10-6-3-7-11-20)23(27)28-24(30)34-17-19-8-4-2-5-9-19/h2-11,21-23H,12-18H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | KBTXVGLLNQXFIW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|