C24H31ClN6O2 — CID 175499245
4-tert-butyl-N-[6-chloro-1-methoxy-4-phenyl-5-(2H-tetrazol-5-yl)cyclohexa-2,4-dien-1-yl]piperidine-1-carboxamide (PubChem CID 175499245) has the molecular formula C24H31ClN6O2 and a molecular weight of 471.01 g/mol. Its IUPAC name is 4-tert-butyl-N-[6-chloro-1-methoxy-4-phenyl-5-(2H-tetrazol-5-yl)cyclohexa-2,4-dien-1-yl]piperidine-1-carboxamide.
| Compound Name | 4-tert-butyl-N-[6-chloro-1-methoxy-4-phenyl-5-(2H-tetrazol-5-yl)cyclohexa-2,4-dien-1-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 175499245 |
| Molecular Formula | C24H31ClN6O2 |
| Molecular Weight | 471.01 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 4-tert-butyl-N-[6-chloro-1-methoxy-4-phenyl-5-(2H-tetrazol-5-yl)cyclohexa-2,4-dien-1-yl]piperidine-1-carboxamide |
| SMILES | COC1(NC(=O)N2CCC(C(C)(C)C)CC2)C=CC(c2ccccc2)=C(c2nn[nH]n2)C1Cl |
| InChI | InChI=1S/C24H31ClN6O2/c1-23(2,3)17-11-14-31(15-12-17)22(32)26-24(33-4)13-10-18(16-8-6-5-7-9-16)19(20(24)25)21-27-29-30-28-21/h5-10,13,17,20H,11-12,14-15H2,1-4H3,(H,26,32)(H,27,28,29,30) |
| InChIKey | XLUIPSQKXASSIN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.01 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|