C19H22FN3O7 — CID 175500114
[(2R,3R,4S,5R)-2-[5-[formyl(3-phenylpropyl)amino]-2,4-dioxopyrimidin-1-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] hypofluorite (PubChem CID 175500114) has the molecular formula C19H22FN3O7 and a molecular weight of 423.40 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-2-[5-[formyl(3-phenylpropyl)amino]-2,4-dioxopyrimidin-1-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] hypofluorite.
| Compound Name | [(2R,3R,4S,5R)-2-[5-[formyl(3-phenylpropyl)amino]-2,4-dioxopyrimidin-1-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] hypofluorite |
|---|---|
| PubChem CID | 175500114 |
| Molecular Formula | C19H22FN3O7 |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | [(2R,3R,4S,5R)-2-[5-[formyl(3-phenylpropyl)amino]-2,4-dioxopyrimidin-1-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] hypofluorite |
| SMILES | O=CN(CCCc1ccccc1)c1cn([C@@H]2O[C@H](CO)[C@H](O)[C@H]2OF)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H22FN3O7/c20-30-16-15(26)14(10-24)29-18(16)23-9-13(17(27)21-19(23)28)22(11-25)8-4-7-12-5-2-1-3-6-12/h1-3,5-6,9,11,14-16,18,24,26H,4,7-8,10H2,(H,21,27,28)/t14-,15+,16-,18-/m1/s1 |
| InChIKey | LUKOZTJAGSSMGZ-KYHPRHEASA-N |
| XLogP | -0.35 |
| TPSA | 134.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|