C25H25N3O — CID 175502809
2-anilino-N-[2-(5-ethyl-1H-indol-3-yl)ethyl]benzamide (PubChem CID 175502809) has the molecular formula C25H25N3O and a molecular weight of 383.50 g/mol. Its IUPAC name is 2-anilino-N-[2-(5-ethyl-1H-indol-3-yl)ethyl]benzamide.
| Compound Name | 2-anilino-N-[2-(5-ethyl-1H-indol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 175502809 |
| Molecular Formula | C25H25N3O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 2-anilino-N-[2-(5-ethyl-1H-indol-3-yl)ethyl]benzamide |
| SMILES | CCc1ccc2[nH]cc(CCNC(=O)c3ccccc3Nc3ccccc3)c2c1 |
| InChI | InChI=1S/C25H25N3O/c1-2-18-12-13-23-22(16-18)19(17-27-23)14-15-26-25(29)21-10-6-7-11-24(21)28-20-8-4-3-5-9-20/h3-13,16-17,27-28H,2,14-15H2,1H3,(H,26,29) |
| InChIKey | DMUZMBBISUDGSY-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |