C28H30N4O3 — CID 175502824
[3-[2-[(2-anilinobenzoyl)amino]ethyl]-1H-indol-5-yl] N-butylcarbamate (PubChem CID 175502824) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is [3-[2-[(2-anilinobenzoyl)amino]ethyl]-1H-indol-5-yl] N-butylcarbamate.
| Compound Name | [3-[2-[(2-anilinobenzoyl)amino]ethyl]-1H-indol-5-yl] N-butylcarbamate |
|---|---|
| PubChem CID | 175502824 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | [3-[2-[(2-anilinobenzoyl)amino]ethyl]-1H-indol-5-yl] N-butylcarbamate |
| SMILES | CCCCNC(=O)Oc1ccc2[nH]cc(CCNC(=O)c3ccccc3Nc3ccccc3)c2c1 |
| InChI | InChI=1S/C28H30N4O3/c1-2-3-16-30-28(34)35-22-13-14-25-24(18-22)20(19-31-25)15-17-29-27(33)23-11-7-8-12-26(23)32-21-9-5-4-6-10-21/h4-14,18-19,31-32H,2-3,15-17H2,1H3,(H,29,33)(H,30,34) |
| InChIKey | HIIKXHWKAZXAHF-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|