C21H29BrF2N2O2 — CID 175503545
[3-(4-bromo-2,5-difluorophenyl)-3,8-diazabicyclo[3.2.1]octan-1-yl] nonanoate (PubChem CID 175503545) has the molecular formula C21H29BrF2N2O2 and a molecular weight of 459.38 g/mol. Its IUPAC name is [3-(4-bromo-2,5-difluorophenyl)-3,8-diazabicyclo[3.2.1]octan-1-yl] nonanoate.
| Compound Name | [3-(4-bromo-2,5-difluorophenyl)-3,8-diazabicyclo[3.2.1]octan-1-yl] nonanoate |
|---|---|
| PubChem CID | 175503545 |
| Molecular Formula | C21H29BrF2N2O2 |
| Molecular Weight | 459.38 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | [3-(4-bromo-2,5-difluorophenyl)-3,8-diazabicyclo[3.2.1]octan-1-yl] nonanoate |
| SMILES | CCCCCCCCC(=O)OC12CCC(CN(c3cc(F)c(Br)cc3F)C1)N2 |
| InChI | InChI=1S/C21H29BrF2N2O2/c1-2-3-4-5-6-7-8-20(27)28-21-10-9-15(25-21)13-26(14-21)19-12-17(23)16(22)11-18(19)24/h11-12,15,25H,2-10,13-14H2,1H3 |
| InChIKey | LKZVGUYYKQJHJE-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.38 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|