C22H29Cl2N5O2S — CID 175555691
[3-[5-(4,6-dichloro-3-pyridinyl)-1,3,4-thiadiazol-2-yl]-3,8-diazabicyclo[3.2.1]octan-1-yl] nonanoate (PubChem CID 175555691) has the molecular formula C22H29Cl2N5O2S and a molecular weight of 498.48 g/mol. Its IUPAC name is [3-[5-(4,6-dichloro-3-pyridinyl)-1,3,4-thiadiazol-2-yl]-3,8-diazabicyclo[3.2.1]octan-1-yl] nonanoate.
| Compound Name | [3-[5-(4,6-dichloro-3-pyridinyl)-1,3,4-thiadiazol-2-yl]-3,8-diazabicyclo[3.2.1]octan-1-yl] nonanoate |
|---|---|
| PubChem CID | 175555691 |
| Molecular Formula | C22H29Cl2N5O2S |
| Molecular Weight | 498.48 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | [3-[5-(4,6-dichloro-3-pyridinyl)-1,3,4-thiadiazol-2-yl]-3,8-diazabicyclo[3.2.1]octan-1-yl] nonanoate |
| SMILES | CCCCCCCCC(=O)OC12CCC(CN(c3nnc(-c4cnc(Cl)cc4Cl)s3)C1)N2 |
| InChI | InChI=1S/C22H29Cl2N5O2S/c1-2-3-4-5-6-7-8-19(30)31-22-10-9-15(26-22)13-29(14-22)21-28-27-20(32-21)16-12-25-18(24)11-17(16)23/h11-12,15,26H,2-10,13-14H2,1H3 |
| InChIKey | IBMUBRCPQVBLBX-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|