C11H21N — CID 175503648
5-ethyl-1-pentyl-2,3-dihydropyrrole (PubChem CID 175503648) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is 5-ethyl-1-pentyl-2,3-dihydropyrrole.
| Compound Name | 5-ethyl-1-pentyl-2,3-dihydropyrrole |
|---|---|
| PubChem CID | 175503648 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 5-ethyl-1-pentyl-2,3-dihydropyrrole |
| SMILES | CCCCCN1CCC=C1CC |
| InChI | InChI=1S/C11H21N/c1-3-5-6-9-12-10-7-8-11(12)4-2/h8H,3-7,9-10H2,1-2H3 |
| InChIKey | NMIXXYBAWQXNAN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|