C23H44N2O — CID 57217187
2-(5-heptadecan-8-yl-2,3-dihydropyrrol-1-yl)acetamide (PubChem CID 57217187) has the molecular formula C23H44N2O and a molecular weight of 364.62 g/mol. Its IUPAC name is 2-(5-heptadecan-8-yl-2,3-dihydropyrrol-1-yl)acetamide.
| Compound Name | 2-(5-heptadecan-8-yl-2,3-dihydropyrrol-1-yl)acetamide |
|---|---|
| PubChem CID | 57217187 |
| Molecular Formula | C23H44N2O |
| Molecular Weight | 364.62 g/mol |
| Exact Mass | 364.35 |
| IUPAC Name | 2-(5-heptadecan-8-yl-2,3-dihydropyrrol-1-yl)acetamide |
| SMILES | CCCCCCCCCC(CCCCCCC)C1=CCCN1CC(N)=O |
| InChI | InChI=1S/C23H44N2O/c1-3-5-7-9-10-12-14-17-21(16-13-11-8-6-4-2)22-18-15-19-25(22)20-23(24)26/h18,21H,3-17,19-20H2,1-2H3,(H2,24,26) |
| InChIKey | BBVZGEVAPYFLEU-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.62 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|