About 2-(5-heptadecan-8-yl-2,3-dihydropyrrol-1-yl)acetamide
2-(5-heptadecan-8-yl-2,3-dihydropyrrol-1-yl)acetamide (PubChem CID 57217187) has the molecular formula C23H44N2O
and a molecular weight of 364.62 g/mol. Its IUPAC name is 2-(5-heptadecan-8-yl-2,3-dihydropyrrol-1-yl)acetamide.
Molecular Properties
| Compound Name | 2-(5-heptadecan-8-yl-2,3-dihydropyrrol-1-yl)acetamide |
| PubChem CID | 57217187 |
| Molecular Formula | C23H44N2O |
| Molecular Weight | 364.62 g/mol |
| Exact Mass | 364.35 |
| IUPAC Name | 2-(5-heptadecan-8-yl-2,3-dihydropyrrol-1-yl)acetamide |
| SMILES | CCCCCCCCCC(CCCCCCC)C1=CCCN1CC(N)=O |
| InChI | InChI=1S/C23H44N2O/c1-3-5-7-9-10-12-14-17-21(16-13-11-8-6-4-2)22-18-15-19-25(22)20-23(24)26/h18,21H,3-17,19-20H2,1-2H3,(H2,24,26) |
| InChIKey | BBVZGEVAPYFLEU-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.62 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-heptadecan-8-yl-2,3-dihydropyrrol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-heptadecan-8-yl-2,3-dihydropyrrol-1-yl)acetamide?
The IUPAC name of 2-(5-heptadecan-8-yl-2,3-dihydropyrrol-1-yl)acetamide (CID 57217187) is 2-(5-heptadecan-8-yl-2,3-dihydropyrrol-1-yl)acetamide.
What is the SMILES notation for 2-(5-heptadecan-8-yl-2,3-dihydropyrrol-1-yl)acetamide?
The canonical SMILES for 2-(5-heptadecan-8-yl-2,3-dihydropyrrol-1-yl)acetamide is CCCCCCCCCC(CCCCCCC)C1=CCCN1CC(N)=O.
What is the InChIKey of 2-(5-heptadecan-8-yl-2,3-dihydropyrrol-1-yl)acetamide?
The InChIKey is BBVZGEVAPYFLEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H44N2O/c1-3-5-7-9-10-12-14-17-21(16-13-11-8-6-4-2)22-18-15-19-25(22)20-23(24)26/h18,21H,3-17,19-20H2,1-2H3,(H2,24,26).
What are the key properties of 2-(5-heptadecan-8-yl-2,3-dihydropyrrol-1-yl)acetamide?
2-(5-heptadecan-8-yl-2,3-dihydropyrrol-1-yl)acetamide has a molecular weight of 364.62 g/mol, XLogP of 6.18, 17 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-heptadecan-8-yl-2,3-dihydropyrrol-1-yl)acetamide is sourced from PubChem (CID 57217187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).