About 3-(4-aminophenyl)aniline;(4-aminophenyl) benzenesulfonate
3-(4-aminophenyl)aniline;(4-aminophenyl) benzenesulfonate (PubChem CID 175507273) has the molecular formula C24H23N3O3S
and a molecular weight of 433.53 g/mol. Its IUPAC name is 3-(4-aminophenyl)aniline;(4-aminophenyl) benzenesulfonate.
Molecular Properties
| Compound Name | 3-(4-aminophenyl)aniline;(4-aminophenyl) benzenesulfonate |
| PubChem CID | 175507273 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 3-(4-aminophenyl)aniline;(4-aminophenyl) benzenesulfonate |
| SMILES | Nc1ccc(-c2cccc(N)c2)cc1.Nc1ccc(OS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C12H12N2.C12H11NO3S/c13-11-6-4-9(5-7-11)10-2-1-3-12(14)8-10;13-10-6-8-11(9-7-10)16-17(14,15)12-4-2-1-3-5-12/h1-8H,13-14H2;1-9H,13H2 |
| InChIKey | YZWBNUONSRNBLD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 121.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-aminophenyl)aniline;(4-aminophenyl) benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-aminophenyl)aniline;(4-aminophenyl) benzenesulfonate?
The IUPAC name of 3-(4-aminophenyl)aniline;(4-aminophenyl) benzenesulfonate (CID 175507273) is 3-(4-aminophenyl)aniline;(4-aminophenyl) benzenesulfonate.
What is the SMILES notation for 3-(4-aminophenyl)aniline;(4-aminophenyl) benzenesulfonate?
The canonical SMILES for 3-(4-aminophenyl)aniline;(4-aminophenyl) benzenesulfonate is Nc1ccc(-c2cccc(N)c2)cc1.Nc1ccc(OS(=O)(=O)c2ccccc2)cc1.
What is the InChIKey of 3-(4-aminophenyl)aniline;(4-aminophenyl) benzenesulfonate?
The InChIKey is YZWBNUONSRNBLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2.C12H11NO3S/c13-11-6-4-9(5-7-11)10-2-1-3-12(14)8-10;13-10-6-8-11(9-7-10)16-17(14,15)12-4-2-1-3-5-12/h1-8H,13-14H2;1-9H,13H2.
What are the key properties of 3-(4-aminophenyl)aniline;(4-aminophenyl) benzenesulfonate?
3-(4-aminophenyl)aniline;(4-aminophenyl) benzenesulfonate has a molecular weight of 433.53 g/mol, XLogP of 4.55, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-aminophenyl)aniline;(4-aminophenyl) benzenesulfonate is sourced from PubChem (CID 175507273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).